C30H46O10 — CID 21141675
tetratert-butyl (3S,6S)-3,6-dimethyl-2,5-dioxo-1,3a,4,6a-tetrahydropentalene-1,3,4,6-tetracarboxylate (PubChem CID 21141675) has the molecular formula C30H46O10 and a molecular weight of 566.69 g/mol. Its IUPAC name is tetratert-butyl (3S,6S)-3,6-dimethyl-2,5-dioxo-1,3a,4,6a-tetrahydropentalene-1,3,4,6-tetracarboxylate.
| Compound Name | tetratert-butyl (3S,6S)-3,6-dimethyl-2,5-dioxo-1,3a,4,6a-tetrahydropentalene-1,3,4,6-tetracarboxylate |
|---|---|
| PubChem CID | 21141675 |
| Molecular Formula | C30H46O10 |
| Molecular Weight | 566.69 g/mol |
| Exact Mass | 566.31 |
| IUPAC Name | tetratert-butyl (3S,6S)-3,6-dimethyl-2,5-dioxo-1,3a,4,6a-tetrahydropentalene-1,3,4,6-tetracarboxylate |
| SMILES | CC(C)(C)OC(=O)C1C(=O)C(C)(C(=O)OC(C)(C)C)C2C(C(=O)OC(C)(C)C)C(=O)C(C)(C(=O)OC(C)(C)C)C12 |
| InChI | InChI=1S/C30H46O10/c1-25(2,3)37-21(33)15-17-18(30(14,19(15)31)24(36)40-28(10,11)12)16(22(34)38-26(4,5)6)20(32)29(17,13)23(35)39-27(7,8)9/h15-18H,1-14H3 |
| InChIKey | RHURWSFYUXBQRT-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.69 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|