C15H20O5 — CID 102435346
tert-butyl (3aR,7aR)-3,7a-dimethyl-2,5-dioxo-3a,4-dihydro-1-benzofuran-3-carboxylate (PubChem CID 102435346) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is tert-butyl (3aR,7aR)-3,7a-dimethyl-2,5-dioxo-3a,4-dihydro-1-benzofuran-3-carboxylate.
| Compound Name | tert-butyl (3aR,7aR)-3,7a-dimethyl-2,5-dioxo-3a,4-dihydro-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 102435346 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | tert-butyl (3aR,7aR)-3,7a-dimethyl-2,5-dioxo-3a,4-dihydro-1-benzofuran-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(C)C(=O)O[C@]2(C)C=CC(=O)C[C@H]12 |
| InChI | InChI=1S/C15H20O5/c1-13(2,3)19-11(17)15(5)10-8-9(16)6-7-14(10,4)20-12(15)18/h6-7,10H,8H2,1-5H3/t10-,14+,15?/m0/s1 |
| InChIKey | VPMOZJBTDWGNBC-XHDDUAGMSA-N |
| XLogP | 1.80 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|