C18H26O4 — CID 177465864
tert-butyl (1R,2R,3S,6R,7S,8R)-8-methyl-11-oxo-12-oxatetracyclo[6.3.1.13,6.02,7]tridecane-1-carboxylate (PubChem CID 177465864) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is tert-butyl (1R,2R,3S,6R,7S,8R)-8-methyl-11-oxo-12-oxatetracyclo[6.3.1.13,6.02,7]tridecane-1-carboxylate.
| Compound Name | tert-butyl (1R,2R,3S,6R,7S,8R)-8-methyl-11-oxo-12-oxatetracyclo[6.3.1.13,6.02,7]tridecane-1-carboxylate |
|---|---|
| PubChem CID | 177465864 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | tert-butyl (1R,2R,3S,6R,7S,8R)-8-methyl-11-oxo-12-oxatetracyclo[6.3.1.13,6.02,7]tridecane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@]12O[C@](C)(CCC1=O)[C@H]1[C@@H]3CC[C@@H](C3)[C@H]12 |
| InChI | InChI=1S/C18H26O4/c1-16(2,3)21-15(20)18-12(19)7-8-17(4,22-18)13-10-5-6-11(9-10)14(13)18/h10-11,13-14H,5-9H2,1-4H3/t10-,11+,13+,14-,17-,18+/m1/s1 |
| InChIKey | GZHLHLXMTJKETP-IIFHCLSYSA-N |
| XLogP | 2.88 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|