C17H29NO3 — CID 146248477
tert-butyl (8aR)-5,5,8a-trimethyl-6-oxo-1,3,4,4a,7,8-hexahydroisoquinoline-2-carboxylate (PubChem CID 146248477) has the molecular formula C17H29NO3 and a molecular weight of 295.42 g/mol. Its IUPAC name is tert-butyl (8aR)-5,5,8a-trimethyl-6-oxo-1,3,4,4a,7,8-hexahydroisoquinoline-2-carboxylate.
| Compound Name | tert-butyl (8aR)-5,5,8a-trimethyl-6-oxo-1,3,4,4a,7,8-hexahydroisoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 146248477 |
| Molecular Formula | C17H29NO3 |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | tert-butyl (8aR)-5,5,8a-trimethyl-6-oxo-1,3,4,4a,7,8-hexahydroisoquinoline-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2C(C)(C)C(=O)CC[C@@]2(C)C1 |
| InChI | InChI=1S/C17H29NO3/c1-15(2,3)21-14(20)18-10-8-12-16(4,5)13(19)7-9-17(12,6)11-18/h12H,7-11H2,1-6H3/t12?,17-/m0/s1 |
| InChIKey | NYBDTVQXWAAXDH-TYJDENFWSA-N |
| XLogP | 3.64 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |