C19H28N2O3 — CID 153279153
tert-butyl (5aS,9aS)-7-isocyano-5a,9,9-trimethyl-8-oxo-2,4,5,9a-tetrahydro-1H-3-benzazepine-3-carboxylate (PubChem CID 153279153) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is tert-butyl (5aS,9aS)-7-isocyano-5a,9,9-trimethyl-8-oxo-2,4,5,9a-tetrahydro-1H-3-benzazepine-3-carboxylate.
| Compound Name | tert-butyl (5aS,9aS)-7-isocyano-5a,9,9-trimethyl-8-oxo-2,4,5,9a-tetrahydro-1H-3-benzazepine-3-carboxylate |
|---|---|
| PubChem CID | 153279153 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | tert-butyl (5aS,9aS)-7-isocyano-5a,9,9-trimethyl-8-oxo-2,4,5,9a-tetrahydro-1H-3-benzazepine-3-carboxylate |
| SMILES | [C-]#[N+]C1=C[C@@]2(C)CCN(C(=O)OC(C)(C)C)CC[C@@H]2C(C)(C)C1=O |
| InChI | InChI=1S/C19H28N2O3/c1-17(2,3)24-16(23)21-10-8-14-18(4,5)15(22)13(20-7)12-19(14,6)9-11-21/h12,14H,8-11H2,1-6H3/t14-,19-/m1/s1 |
| InChIKey | DMECEFHTCAMZRL-AUUYWEPGSA-N |
| XLogP | 4.05 |
| TPSA | 50.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|