C43H62N2O6 — CID 139291282
tert-butyl 4-[3-(11-isocyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicen-4a-yl)propanoyloxy]piperidine-1-carboxylate (PubChem CID 139291282) has the molecular formula C43H62N2O6 and a molecular weight of 702.98 g/mol. Its IUPAC name is tert-butyl 4-[3-(11-isocyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicen-4a-yl)propanoyloxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-(11-isocyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicen-4a-yl)propanoyloxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 139291282 |
| Molecular Formula | C43H62N2O6 |
| Molecular Weight | 702.98 g/mol |
| Exact Mass | 702.46 |
| IUPAC Name | tert-butyl 4-[3-(11-isocyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicen-4a-yl)propanoyloxy]piperidine-1-carboxylate |
| SMILES | [C-]#[N+]C1=CC2(C)C3=CC(=O)C4C5CC(C)(C)CCC5(CCC(=O)OC5CCN(C(=O)OC(C)(C)C)CC5)CCC4(C)C3(C)CCC2C(C)(C)C1=O |
| InChI | InChI=1S/C43H62N2O6/c1-37(2,3)51-36(49)45-22-14-27(15-23-45)50-33(47)13-17-43-20-18-38(4,5)25-28(43)34-30(46)24-32-40(8)26-29(44-11)35(48)39(6,7)31(40)12-16-41(32,9)42(34,10)19-21-43/h24,26-28,31,34H,12-23,25H2,1-10H3 |
| InChIKey | IVFHDDSFGXXDST-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 94.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.98 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|