C32H46N2O4S — CID 123357179
N-[(4aS,6aR,6bS,8aR,12aR)-11-isocyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicen-4a-yl]ethanesulfonamide (PubChem CID 123357179) has the molecular formula C32H46N2O4S and a molecular weight of 554.80 g/mol. Its IUPAC name is N-[(4aS,6aR,6bS,8aR,12aR)-11-isocyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicen-4a-yl]ethanesulfonamide.
| Compound Name | N-[(4aS,6aR,6bS,8aR,12aR)-11-isocyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicen-4a-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 123357179 |
| Molecular Formula | C32H46N2O4S |
| Molecular Weight | 554.80 g/mol |
| Exact Mass | 554.32 |
| IUPAC Name | N-[(4aS,6aR,6bS,8aR,12aR)-11-isocyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicen-4a-yl]ethanesulfonamide |
| SMILES | [C-]#[N+]C1=C[C@]2(C)C3=CC(=O)C4C5CC(C)(C)CC[C@]5(NS(=O)(=O)CC)CC[C@@]4(C)[C@]3(C)CC[C@H]2C(C)(C)C1=O |
| InChI | InChI=1S/C32H46N2O4S/c1-10-39(37,38)34-32-15-13-27(2,3)18-20(32)25-22(35)17-24-29(6)19-21(33-9)26(36)28(4,5)23(29)11-12-30(24,7)31(25,8)14-16-32/h17,19-20,23,25,34H,10-16,18H2,1-8H3/t20?,23-,25?,29-,30+,31+,32-/m0/s1 |
| InChIKey | AQLUULMCYUCENB-IZHJQFOVSA-N |
| XLogP | 6.25 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.80 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|