C31H44N2O4S — CID 77232640
N-(11-cyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicen-4a-yl)methanesulfonamide (PubChem CID 77232640) has the molecular formula C31H44N2O4S and a molecular weight of 540.77 g/mol. Its IUPAC name is N-(11-cyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicen-4a-yl)methanesulfonamide.
| Compound Name | N-(11-cyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicen-4a-yl)methanesulfonamide |
|---|---|
| PubChem CID | 77232640 |
| Molecular Formula | C31H44N2O4S |
| Molecular Weight | 540.77 g/mol |
| Exact Mass | 540.30 |
| IUPAC Name | N-(11-cyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicen-4a-yl)methanesulfonamide |
| SMILES | CC1(C)CCC2(NS(C)(=O)=O)CCC3(C)C(C(=O)C=C4C5(C)C=C(C#N)C(=O)C(C)(C)C5CCC43C)C2C1 |
| InChI | InChI=1S/C31H44N2O4S/c1-26(2)11-13-31(33-38(8,36)37)14-12-30(7)24(20(31)17-26)21(34)15-23-28(5)16-19(18-32)25(35)27(3,4)22(28)9-10-29(23,30)6/h15-16,20,22,24,33H,9-14,17H2,1-8H3 |
| InChIKey | OAPPQGIUHUKHBW-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 104.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.77 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |