C33H44N2O3 — CID 156517280
N-[(4aS,6aR,6bS,12aS,14aR)-11-cyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicen-4a-yl]prop-2-enamide (PubChem CID 156517280) has the molecular formula C33H44N2O3 and a molecular weight of 516.73 g/mol. Its IUPAC name is N-[(4aS,6aR,6bS,12aS,14aR)-11-cyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicen-4a-yl]prop-2-enamide.
| Compound Name | N-[(4aS,6aR,6bS,12aS,14aR)-11-cyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicen-4a-yl]prop-2-enamide |
|---|---|
| PubChem CID | 156517280 |
| Molecular Formula | C33H44N2O3 |
| Molecular Weight | 516.73 g/mol |
| Exact Mass | 516.34 |
| IUPAC Name | N-[(4aS,6aR,6bS,12aS,14aR)-11-cyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicen-4a-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@]12CCC(C)(C)CC1[C@H]1C(=O)C=C3[C@@]4(C)C=C(C#N)C(=O)C(C)(C)C4CC[C@@]3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C33H44N2O3/c1-9-25(37)35-33-14-12-28(2,3)18-21(33)26-22(36)16-24-30(6)17-20(19-34)27(38)29(4,5)23(30)10-11-31(24,7)32(26,8)13-15-33/h9,16-17,21,23,26H,1,10-15,18H2,2-8H3,(H,35,37)/t21?,23?,26-,30-,31+,32+,33-/m0/s1 |
| InChIKey | UNKZWMNKZZBQSO-DHZSZGNSSA-N |
| XLogP | 6.26 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.73 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|