C39H50N2O2 — CID 89143120
(4aR,6aS,6bR,8aS,14bS)-4,4,6a,6b,11,11,14b-heptamethyl-3,13-dioxo-8a-(3-phenylprop-1-en-2-ylamino)-4a,5,6,6a,7,8,9,10,12,12a-decahydropicene-2-carbonitrile (PubChem CID 89143120) has the molecular formula C39H50N2O2 and a molecular weight of 578.84 g/mol. Its IUPAC name is (4aR,6aS,6bR,8aS,14bS)-4,4,6a,6b,11,11,14b-heptamethyl-3,13-dioxo-8a-(3-phenylprop-1-en-2-ylamino)-4a,5,6,6a,7,8,9,10,12,12a-decahydropicene-2-carbonitrile.
| Compound Name | (4aR,6aS,6bR,8aS,14bS)-4,4,6a,6b,11,11,14b-heptamethyl-3,13-dioxo-8a-(3-phenylprop-1-en-2-ylamino)-4a,5,6,6a,7,8,9,10,12,12a-decahydropicene-2-carbonitrile |
|---|---|
| PubChem CID | 89143120 |
| Molecular Formula | C39H50N2O2 |
| Molecular Weight | 578.84 g/mol |
| Exact Mass | 578.39 |
| IUPAC Name | (4aR,6aS,6bR,8aS,14bS)-4,4,6a,6b,11,11,14b-heptamethyl-3,13-dioxo-8a-(3-phenylprop-1-en-2-ylamino)-4a,5,6,6a,7,8,9,10,12,12a-decahydropicene-2-carbonitrile |
| SMILES | C=C(Cc1ccccc1)N[C@]12CCC(C)(C)CC1C1C(=O)C=C3[C@@]4(C)C=C(C#N)C(=O)C(C)(C)[C@@H]4CC[C@@]3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C39H50N2O2/c1-25(20-26-12-10-9-11-13-26)41-39-18-16-34(2,3)23-28(39)32-29(42)21-31-36(6)22-27(24-40)33(43)35(4,5)30(36)14-15-37(31,7)38(32,8)17-19-39/h9-13,21-22,28,30,32,41H,1,14-20,23H2,2-8H3/t28?,30-,32?,36-,37+,38+,39-/m0/s1 |
| InChIKey | WFWZFUILCXVWCU-SFNMPMFMSA-N |
| XLogP | 8.30 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.84 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |