C33H46N2O2S — CID 123992639
8a-(cyclopropylsulfanylamino)-4,4,6a,6b,11,11,14b-heptamethyl-3,13-dioxo-4a,5,6,6a,7,8,9,10,12,12a-decahydropicene-2-carbonitrile (PubChem CID 123992639) has the molecular formula C33H46N2O2S and a molecular weight of 534.81 g/mol. Its IUPAC name is 8a-(cyclopropylsulfanylamino)-4,4,6a,6b,11,11,14b-heptamethyl-3,13-dioxo-4a,5,6,6a,7,8,9,10,12,12a-decahydropicene-2-carbonitrile.
| Compound Name | 8a-(cyclopropylsulfanylamino)-4,4,6a,6b,11,11,14b-heptamethyl-3,13-dioxo-4a,5,6,6a,7,8,9,10,12,12a-decahydropicene-2-carbonitrile |
|---|---|
| PubChem CID | 123992639 |
| Molecular Formula | C33H46N2O2S |
| Molecular Weight | 534.81 g/mol |
| Exact Mass | 534.33 |
| IUPAC Name | 8a-(cyclopropylsulfanylamino)-4,4,6a,6b,11,11,14b-heptamethyl-3,13-dioxo-4a,5,6,6a,7,8,9,10,12,12a-decahydropicene-2-carbonitrile |
| SMILES | CC1(C)CCC2(NSC3CC3)CCC3(C)C(C(=O)C=C4C5(C)C=C(C#N)C(=O)C(C)(C)C5CCC43C)C2C1 |
| InChI | InChI=1S/C33H46N2O2S/c1-28(2)12-14-33(35-38-21-8-9-21)15-13-32(7)26(22(33)18-28)23(36)16-25-30(5)17-20(19-34)27(37)29(3,4)24(30)10-11-31(25,32)6/h16-17,21-22,24,26,35H,8-15,18H2,1-7H3 |
| InChIKey | KMIBTBQFRQUEPZ-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.81 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|