C31H40N2O3 — CID 134527076
(4aR,6aS,6aS,6bR,8aS,14bS)-8a-isocyanato-4,4,6a,6b,11,11,14b-heptamethyl-3,13-dioxo-4a,5,6,6a,7,8,9,10,12,12a-decahydropicene-2-carbonitrile (PubChem CID 134527076) has the molecular formula C31H40N2O3 and a molecular weight of 488.67 g/mol. Its IUPAC name is (4aR,6aS,6aS,6bR,8aS,14bS)-8a-isocyanato-4,4,6a,6b,11,11,14b-heptamethyl-3,13-dioxo-4a,5,6,6a,7,8,9,10,12,12a-decahydropicene-2-carbonitrile.
| Compound Name | (4aR,6aS,6aS,6bR,8aS,14bS)-8a-isocyanato-4,4,6a,6b,11,11,14b-heptamethyl-3,13-dioxo-4a,5,6,6a,7,8,9,10,12,12a-decahydropicene-2-carbonitrile |
|---|---|
| PubChem CID | 134527076 |
| Molecular Formula | C31H40N2O3 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.30 |
| IUPAC Name | (4aR,6aS,6aS,6bR,8aS,14bS)-8a-isocyanato-4,4,6a,6b,11,11,14b-heptamethyl-3,13-dioxo-4a,5,6,6a,7,8,9,10,12,12a-decahydropicene-2-carbonitrile |
| SMILES | CC1(C)CC[C@]2(N=C=O)CC[C@]3(C)[C@@H](C(=O)C=C4[C@@]5(C)C=C(C#N)C(=O)C(C)(C)[C@@H]5CC[C@]43C)C2C1 |
| InChI | InChI=1S/C31H40N2O3/c1-26(2)10-12-31(33-18-34)13-11-30(7)24(20(31)16-26)21(35)14-23-28(5)15-19(17-32)25(36)27(3,4)22(28)8-9-29(23,30)6/h14-15,20,22,24H,8-13,16H2,1-7H3/t20?,22-,24+,28-,29+,30+,31-/m0/s1 |
| InChIKey | IHWBAGOEUHPWHZ-XVIYQICZSA-N |
| XLogP | 6.29 |
| TPSA | 87.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|