C34H46N2O3 — CID 156517277
N-[(4aS,6aR,6bS,12aS,14aR)-11-cyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicen-4a-yl]cyclopropanecarboxamide (PubChem CID 156517277) has the molecular formula C34H46N2O3 and a molecular weight of 530.75 g/mol. Its IUPAC name is N-[(4aS,6aR,6bS,12aS,14aR)-11-cyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicen-4a-yl]cyclopropanecarboxamide.
| Compound Name | N-[(4aS,6aR,6bS,12aS,14aR)-11-cyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicen-4a-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 156517277 |
| Molecular Formula | C34H46N2O3 |
| Molecular Weight | 530.75 g/mol |
| Exact Mass | 530.35 |
| IUPAC Name | N-[(4aS,6aR,6bS,12aS,14aR)-11-cyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicen-4a-yl]cyclopropanecarboxamide |
| SMILES | CC1(C)CC[C@]2(NC(=O)C3CC3)CC[C@]3(C)[C@H](C(=O)C=C4[C@@]5(C)C=C(C#N)C(=O)C(C)(C)C5CC[C@]43C)C2C1 |
| InChI | InChI=1S/C34H46N2O3/c1-29(2)12-14-34(36-28(39)20-8-9-20)15-13-33(7)26(22(34)18-29)23(37)16-25-31(5)17-21(19-35)27(38)30(3,4)24(31)10-11-32(25,33)6/h16-17,20,22,24,26H,8-15,18H2,1-7H3,(H,36,39)/t22?,24?,26-,31-,32+,33+,34-/m0/s1 |
| InChIKey | JFWPXROQNGLOCC-DJVLMMKUSA-N |
| XLogP | 6.48 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.75 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |