C38H48N2O4 — CID 59203298
benzyl N-[(4aS,6aR,6bS,8aR,12aR,14aR,14bS)-11-isocyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicen-4a-yl]carbamate (PubChem CID 59203298) has the molecular formula C38H48N2O4 and a molecular weight of 596.81 g/mol. Its IUPAC name is benzyl N-[(4aS,6aR,6bS,8aR,12aR,14aR,14bS)-11-isocyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicen-4a-yl]carbamate.
| Compound Name | benzyl N-[(4aS,6aR,6bS,8aR,12aR,14aR,14bS)-11-isocyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicen-4a-yl]carbamate |
|---|---|
| PubChem CID | 59203298 |
| Molecular Formula | C38H48N2O4 |
| Molecular Weight | 596.81 g/mol |
| Exact Mass | 596.36 |
| IUPAC Name | benzyl N-[(4aS,6aR,6bS,8aR,12aR,14aR,14bS)-11-isocyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicen-4a-yl]carbamate |
| SMILES | [C-]#[N+]C1=C[C@]2(C)C3=CC(=O)[C@@H]4[C@@H]5CC(C)(C)CC[C@]5(NC(=O)OCc5ccccc5)CC[C@@]4(C)[C@]3(C)CC[C@H]2C(C)(C)C1=O |
| InChI | InChI=1S/C38H48N2O4/c1-33(2)16-18-38(40-32(43)44-23-24-12-10-9-11-13-24)19-17-37(7)30(25(38)21-33)27(41)20-29-35(5)22-26(39-8)31(42)34(3,4)28(35)14-15-36(29,37)6/h9-13,20,22,25,28,30H,14-19,21,23H2,1-7H3,(H,40,43)/t25-,28-,30-,35-,36+,37+,38-/m0/s1 |
| InChIKey | JDVLOZDPPZZYGJ-ABZWVVOASA-N |
| XLogP | 8.24 |
| TPSA | 76.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.81 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|