C34H46F2N2O3 — CID 88892327
2-[(4aR,6aR,6bS,8aR,12aR,14aR,14bS)-11-isocyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicen-4a-yl]-N-(2,2-difluoroethyl)acetamide (PubChem CID 88892327) has the molecular formula C34H46F2N2O3 and a molecular weight of 568.75 g/mol. Its IUPAC name is 2-[(4aR,6aR,6bS,8aR,12aR,14aR,14bS)-11-isocyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicen-4a-yl]-N-(2,2-difluoroethyl)acetamide.
| Compound Name | 2-[(4aR,6aR,6bS,8aR,12aR,14aR,14bS)-11-isocyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicen-4a-yl]-N-(2,2-difluoroethyl)acetamide |
|---|---|
| PubChem CID | 88892327 |
| Molecular Formula | C34H46F2N2O3 |
| Molecular Weight | 568.75 g/mol |
| Exact Mass | 568.35 |
| IUPAC Name | 2-[(4aR,6aR,6bS,8aR,12aR,14aR,14bS)-11-isocyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicen-4a-yl]-N-(2,2-difluoroethyl)acetamide |
| SMILES | [C-]#[N+]C1=C[C@]2(C)C3=CC(=O)[C@@H]4[C@@H]5CC(C)(C)CC[C@]5(CC(=O)NCC(F)F)CC[C@@]4(C)[C@]3(C)CC[C@H]2C(C)(C)C1=O |
| InChI | InChI=1S/C34H46F2N2O3/c1-29(2)11-13-34(18-26(40)38-19-25(35)36)14-12-33(7)27(20(34)16-29)22(39)15-24-31(5)17-21(37-8)28(41)30(3,4)23(31)9-10-32(24,33)6/h15,17,20,23,25,27H,9-14,16,18-19H2,1-7H3,(H,38,40)/t20-,23-,27-,31-,32+,33+,34+/m0/s1 |
| InChIKey | YTWQRVBGKIOJRX-STQGUPOQSA-N |
| XLogP | 7.33 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.75 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|