C34H47NO4 — CID 170093272
methyl 3-[(4aR,6aR,6bS,8aR,12aS,14bR)-11-cyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicen-4a-yl]propanoate (PubChem CID 170093272) has the molecular formula C34H47NO4 and a molecular weight of 533.75 g/mol. Its IUPAC name is methyl 3-[(4aR,6aR,6bS,8aR,12aS,14bR)-11-cyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicen-4a-yl]propanoate.
| Compound Name | methyl 3-[(4aR,6aR,6bS,8aR,12aS,14bR)-11-cyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicen-4a-yl]propanoate |
|---|---|
| PubChem CID | 170093272 |
| Molecular Formula | C34H47NO4 |
| Molecular Weight | 533.75 g/mol |
| Exact Mass | 533.35 |
| IUPAC Name | methyl 3-[(4aR,6aR,6bS,8aR,12aS,14bR)-11-cyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicen-4a-yl]propanoate |
| SMILES | COC(=O)CC[C@]12CCC(C)(C)C[C@@H]1C1C(=O)C=C3[C@@]4(C)C=C(C#N)C(=O)C(C)(C)[C@@H]4CC[C@@]3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C34H47NO4/c1-29(2)13-15-34(12-10-26(37)39-8)16-14-33(7)27(22(34)19-29)23(36)17-25-31(5)18-21(20-35)28(38)30(3,4)24(31)9-11-32(25,33)6/h17-18,22,24,27H,9-16,19H2,1-8H3/t22-,24+,27?,31+,32-,33-,34-/m1/s1 |
| InChIKey | DQYWYOVJGUGGNG-ZWSDUPHUSA-N |
| XLogP | 7.16 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.75 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |