C37H53NO4 — CID 123555810
tert-butyl 3-(11-cyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicen-4a-yl)propanoate (PubChem CID 123555810) has the molecular formula C37H53NO4 and a molecular weight of 575.83 g/mol. Its IUPAC name is tert-butyl 3-(11-cyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicen-4a-yl)propanoate.
| Compound Name | tert-butyl 3-(11-cyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicen-4a-yl)propanoate |
|---|---|
| PubChem CID | 123555810 |
| Molecular Formula | C37H53NO4 |
| Molecular Weight | 575.83 g/mol |
| Exact Mass | 575.40 |
| IUPAC Name | tert-butyl 3-(11-cyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicen-4a-yl)propanoate |
| SMILES | CC1(C)CCC2(CCC(=O)OC(C)(C)C)CCC3(C)C(C(=O)C=C4C5(C)C=C(C#N)C(=O)C(C)(C)C5CCC43C)C2C1 |
| InChI | InChI=1S/C37H53NO4/c1-31(2,3)42-28(40)12-14-37-17-15-32(4,5)21-24(37)29-25(39)19-27-34(8)20-23(22-38)30(41)33(6,7)26(34)11-13-35(27,9)36(29,10)16-18-37/h19-20,24,26,29H,11-18,21H2,1-10H3 |
| InChIKey | XLRCMWANDZHFOY-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.83 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |