C18H28N2O3 — CID 153279066
tert-butyl 7-isocyano-5,5,8a-trimethyl-6-oxo-1,3,4,4a,7,8-hexahydroisoquinoline-2-carboxylate (PubChem CID 153279066) has the molecular formula C18H28N2O3 and a molecular weight of 320.43 g/mol. Its IUPAC name is tert-butyl 7-isocyano-5,5,8a-trimethyl-6-oxo-1,3,4,4a,7,8-hexahydroisoquinoline-2-carboxylate.
| Compound Name | tert-butyl 7-isocyano-5,5,8a-trimethyl-6-oxo-1,3,4,4a,7,8-hexahydroisoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 153279066 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | tert-butyl 7-isocyano-5,5,8a-trimethyl-6-oxo-1,3,4,4a,7,8-hexahydroisoquinoline-2-carboxylate |
| SMILES | [C-]#[N+]C1CC2(C)CN(C(=O)OC(C)(C)C)CCC2C(C)(C)C1=O |
| InChI | InChI=1S/C18H28N2O3/c1-16(2,3)23-15(22)20-9-8-13-17(4,5)14(21)12(19-7)10-18(13,6)11-20/h12-13H,8-11H2,1-6H3 |
| InChIKey | LMFPGTUQXFQDMS-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 50.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|