C17H26N2O3 — CID 169023978
tert-butyl 9-isocyano-7,7-dimethyl-8-oxo-2-azaspiro[4.5]decane-2-carboxylate (PubChem CID 169023978) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is tert-butyl 9-isocyano-7,7-dimethyl-8-oxo-2-azaspiro[4.5]decane-2-carboxylate.
| Compound Name | tert-butyl 9-isocyano-7,7-dimethyl-8-oxo-2-azaspiro[4.5]decane-2-carboxylate |
|---|---|
| PubChem CID | 169023978 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | tert-butyl 9-isocyano-7,7-dimethyl-8-oxo-2-azaspiro[4.5]decane-2-carboxylate |
| SMILES | [C-]#[N+]C1CC2(CCN(C(=O)OC(C)(C)C)C2)CC(C)(C)C1=O |
| InChI | InChI=1S/C17H26N2O3/c1-15(2,3)22-14(21)19-8-7-17(11-19)9-12(18-6)13(20)16(4,5)10-17/h12H,7-11H2,1-5H3 |
| InChIKey | KQTKWOQFPZVWMI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 50.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|