C13H24BrNO2 — CID 131141075
tert-butyl 5-bromo-3,3-dimethylazepane-1-carboxylate (PubChem CID 131141075) has the molecular formula C13H24BrNO2 and a molecular weight of 306.24 g/mol. Its IUPAC name is tert-butyl 5-bromo-3,3-dimethylazepane-1-carboxylate.
| Compound Name | tert-butyl 5-bromo-3,3-dimethylazepane-1-carboxylate |
|---|---|
| PubChem CID | 131141075 |
| Molecular Formula | C13H24BrNO2 |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | tert-butyl 5-bromo-3,3-dimethylazepane-1-carboxylate |
| SMILES | CC1(C)CC(Br)CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C13H24BrNO2/c1-12(2,3)17-11(16)15-7-6-10(14)8-13(4,5)9-15/h10H,6-9H2,1-5H3 |
| InChIKey | SWEQHDHIAHTDBJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|