C17H28N2O3 — CID 146108594
tert-butyl 5-(but-2-ynoylamino)-3,3-dimethylazepane-1-carboxylate (PubChem CID 146108594) has the molecular formula C17H28N2O3 and a molecular weight of 308.42 g/mol. Its IUPAC name is tert-butyl 5-(but-2-ynoylamino)-3,3-dimethylazepane-1-carboxylate.
| Compound Name | tert-butyl 5-(but-2-ynoylamino)-3,3-dimethylazepane-1-carboxylate |
|---|---|
| PubChem CID | 146108594 |
| Molecular Formula | C17H28N2O3 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | tert-butyl 5-(but-2-ynoylamino)-3,3-dimethylazepane-1-carboxylate |
| SMILES | CC#CC(=O)NC1CCN(C(=O)OC(C)(C)C)CC(C)(C)C1 |
| InChI | InChI=1S/C17H28N2O3/c1-7-8-14(20)18-13-9-10-19(12-17(5,6)11-13)15(21)22-16(2,3)4/h13H,9-12H2,1-6H3,(H,18,20) |
| InChIKey | CXWWKUHSFUCNQK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|