C16H24N2O3 — CID 178118729
tert-butyl (5S)-7-but-2-ynoyl-2,7-diazaspiro[4.4]nonane-2-carboxylate (PubChem CID 178118729) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is tert-butyl (5S)-7-but-2-ynoyl-2,7-diazaspiro[4.4]nonane-2-carboxylate.
| Compound Name | tert-butyl (5S)-7-but-2-ynoyl-2,7-diazaspiro[4.4]nonane-2-carboxylate |
|---|---|
| PubChem CID | 178118729 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | tert-butyl (5S)-7-but-2-ynoyl-2,7-diazaspiro[4.4]nonane-2-carboxylate |
| SMILES | CC#CC(=O)N1CC[C@]2(CCN(C(=O)OC(C)(C)C)C2)C1 |
| InChI | InChI=1S/C16H24N2O3/c1-5-6-13(19)17-9-7-16(11-17)8-10-18(12-16)14(20)21-15(2,3)4/h7-12H2,1-4H3/t16-/m0/s1 |
| InChIKey | PSVFOCVOIPKSFW-INIZCTEOSA-N |
| XLogP | 1.87 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|