C16H27NO4 — CID 124850116
tert-butyl 4-hydroxy-4-[(1R)-2-oxocyclohexyl]piperidine-1-carboxylate (PubChem CID 124850116) has the molecular formula C16H27NO4 and a molecular weight of 297.39 g/mol. Its IUPAC name is tert-butyl 4-hydroxy-4-[(1R)-2-oxocyclohexyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-hydroxy-4-[(1R)-2-oxocyclohexyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 124850116 |
| Molecular Formula | C16H27NO4 |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | tert-butyl 4-hydroxy-4-[(1R)-2-oxocyclohexyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(O)([C@H]2CCCCC2=O)CC1 |
| InChI | InChI=1S/C16H27NO4/c1-15(2,3)21-14(19)17-10-8-16(20,9-11-17)12-6-4-5-7-13(12)18/h12,20H,4-11H2,1-3H3/t12-/m0/s1 |
| InChIKey | PZPXDHOOEWUWTD-LBPRGKRZSA-N |
| XLogP | 2.51 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |