C21H36O3 — CID 153438182
tert-butyl 1-cyclooctyl-2-oxocyclooctane-1-carboxylate (PubChem CID 153438182) has the molecular formula C21H36O3 and a molecular weight of 336.52 g/mol. Its IUPAC name is tert-butyl 1-cyclooctyl-2-oxocyclooctane-1-carboxylate.
| Compound Name | tert-butyl 1-cyclooctyl-2-oxocyclooctane-1-carboxylate |
|---|---|
| PubChem CID | 153438182 |
| Molecular Formula | C21H36O3 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.27 |
| IUPAC Name | tert-butyl 1-cyclooctyl-2-oxocyclooctane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(C2CCCCCCC2)CCCCCCC1=O |
| InChI | InChI=1S/C21H36O3/c1-20(2,3)24-19(23)21(16-12-8-7-11-15-18(21)22)17-13-9-5-4-6-10-14-17/h17H,4-16H2,1-3H3 |
| InChIKey | DFDUFOZIMPXUBM-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|