C18H24O3 — CID 10266125
tert-butyl 1-benzyl-2-oxocyclohexane-1-carboxylate (PubChem CID 10266125) has the molecular formula C18H24O3 and a molecular weight of 288.39 g/mol. Its IUPAC name is tert-butyl 1-benzyl-2-oxocyclohexane-1-carboxylate.
| Compound Name | tert-butyl 1-benzyl-2-oxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 10266125 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | tert-butyl 1-benzyl-2-oxocyclohexane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(Cc2ccccc2)CCCCC1=O |
| InChI | InChI=1S/C18H24O3/c1-17(2,3)21-16(20)18(12-8-7-11-15(18)19)13-14-9-5-4-6-10-14/h4-6,9-10H,7-8,11-13H2,1-3H3 |
| InChIKey | CNEDPLTXTGTENB-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|