C23H33NO5 — CID 134942076
ditert-butyl 4-benzyl-5-oxoazepane-1,4-dicarboxylate (PubChem CID 134942076) has the molecular formula C23H33NO5 and a molecular weight of 403.52 g/mol. Its IUPAC name is ditert-butyl 4-benzyl-5-oxoazepane-1,4-dicarboxylate.
| Compound Name | ditert-butyl 4-benzyl-5-oxoazepane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 134942076 |
| Molecular Formula | C23H33NO5 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | ditert-butyl 4-benzyl-5-oxoazepane-1,4-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(=O)C(Cc2ccccc2)(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C23H33NO5/c1-21(2,3)28-19(26)23(16-17-10-8-7-9-11-17)13-15-24(14-12-18(23)25)20(27)29-22(4,5)6/h7-11H,12-16H2,1-6H3 |
| InChIKey | VENHMHXRRDRJBC-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|