C22H31NO5 — CID 69363257
3-O-butyl 1-O-tert-butyl 3-benzyl-4-oxopiperidine-1,3-dicarboxylate (PubChem CID 69363257) has the molecular formula C22H31NO5 and a molecular weight of 389.49 g/mol. Its IUPAC name is 3-O-butyl 1-O-tert-butyl 3-benzyl-4-oxopiperidine-1,3-dicarboxylate.
| Compound Name | 3-O-butyl 1-O-tert-butyl 3-benzyl-4-oxopiperidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 69363257 |
| Molecular Formula | C22H31NO5 |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | 3-O-butyl 1-O-tert-butyl 3-benzyl-4-oxopiperidine-1,3-dicarboxylate |
| SMILES | CCCCOC(=O)C1(Cc2ccccc2)CN(C(=O)OC(C)(C)C)CCC1=O |
| InChI | InChI=1S/C22H31NO5/c1-5-6-14-27-19(25)22(15-17-10-8-7-9-11-17)16-23(13-12-18(22)24)20(26)28-21(2,3)4/h7-11H,5-6,12-16H2,1-4H3 |
| InChIKey | HUVBAGIMZMEGOY-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|