C28H40N2O7 — CID 177321318
1-O-tert-butyl 3-O-methyl 4-oxo-3-[3-(1-phenylmethoxycarbonylpiperidin-4-yl)propyl]piperidine-1,3-dicarboxylate (PubChem CID 177321318) has the molecular formula C28H40N2O7 and a molecular weight of 516.64 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-methyl 4-oxo-3-[3-(1-phenylmethoxycarbonylpiperidin-4-yl)propyl]piperidine-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-methyl 4-oxo-3-[3-(1-phenylmethoxycarbonylpiperidin-4-yl)propyl]piperidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 177321318 |
| Molecular Formula | C28H40N2O7 |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.28 |
| IUPAC Name | 1-O-tert-butyl 3-O-methyl 4-oxo-3-[3-(1-phenylmethoxycarbonylpiperidin-4-yl)propyl]piperidine-1,3-dicarboxylate |
| SMILES | COC(=O)C1(CCCC2CCN(C(=O)OCc3ccccc3)CC2)CN(C(=O)OC(C)(C)C)CCC1=O |
| InChI | InChI=1S/C28H40N2O7/c1-27(2,3)37-26(34)30-18-14-23(31)28(20-30,24(32)35-4)15-8-11-21-12-16-29(17-13-21)25(33)36-19-22-9-6-5-7-10-22/h5-7,9-10,21H,8,11-20H2,1-4H3 |
| InChIKey | JTEIRIBQQWXODK-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|