C23H34O3 — CID 101472118
cis-tert-butyl (1S,5R)-1-benzyl-5-tert-butyl-2-oxocycloheptane-1-carboxylate (PubChem CID 101472118) has the molecular formula C23H34O3 and a molecular weight of 358.52 g/mol. Its IUPAC name is cis-tert-butyl (1S,5R)-1-benzyl-5-tert-butyl-2-oxocycloheptane-1-carboxylate.
| Compound Name | cis-tert-butyl (1S,5R)-1-benzyl-5-tert-butyl-2-oxocycloheptane-1-carboxylate |
|---|---|
| PubChem CID | 101472118 |
| Molecular Formula | C23H34O3 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | cis-tert-butyl (1S,5R)-1-benzyl-5-tert-butyl-2-oxocycloheptane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@]1(Cc2ccccc2)CC[C@@H](C(C)(C)C)CCC1=O |
| InChI | InChI=1S/C23H34O3/c1-21(2,3)18-12-13-19(24)23(15-14-18,20(25)26-22(4,5)6)16-17-10-8-7-9-11-17/h7-11,18H,12-16H2,1-6H3/t18-,23-/m0/s1 |
| InChIKey | LEIZRCJFXPPPJO-MBSDFSHPSA-N |
| XLogP | 5.36 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|