C21H27NO4 — CID 135067570
tert-butyl (1R,2S,10R,11R)-1,5,9-trimethyl-12-oxo-15-oxa-9-azatetracyclo[9.3.1.02,10.03,8]pentadeca-3(8),4,6-triene-11-carboxylate (PubChem CID 135067570) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is tert-butyl (1R,2S,10R,11R)-1,5,9-trimethyl-12-oxo-15-oxa-9-azatetracyclo[9.3.1.02,10.03,8]pentadeca-3(8),4,6-triene-11-carboxylate.
| Compound Name | tert-butyl (1R,2S,10R,11R)-1,5,9-trimethyl-12-oxo-15-oxa-9-azatetracyclo[9.3.1.02,10.03,8]pentadeca-3(8),4,6-triene-11-carboxylate |
|---|---|
| PubChem CID | 135067570 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | tert-butyl (1R,2S,10R,11R)-1,5,9-trimethyl-12-oxo-15-oxa-9-azatetracyclo[9.3.1.02,10.03,8]pentadeca-3(8),4,6-triene-11-carboxylate |
| SMILES | Cc1ccc2c(c1)[C@H]1[C@@H](N2C)[C@@]2(C(=O)OC(C)(C)C)O[C@]1(C)CCC2=O |
| InChI | InChI=1S/C21H27NO4/c1-12-7-8-14-13(11-12)16-17(22(14)6)21(18(24)25-19(2,3)4)15(23)9-10-20(16,5)26-21/h7-8,11,16-17H,9-10H2,1-6H3/t16-,17+,20+,21-/m0/s1 |
| InChIKey | HPRXCXGAXQDUFG-NLEAXPPASA-N |
| XLogP | 3.13 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|