C26H34N2O2 — CID 143634212
tert-butyl (5aS)-6-benzyl-5a,9-dimethyl-3,4,5,10b-tetrahydro-1H-azepino[4,3-b]indole-2-carboxylate (PubChem CID 143634212) has the molecular formula C26H34N2O2 and a molecular weight of 406.57 g/mol. Its IUPAC name is tert-butyl (5aS)-6-benzyl-5a,9-dimethyl-3,4,5,10b-tetrahydro-1H-azepino[4,3-b]indole-2-carboxylate.
| Compound Name | tert-butyl (5aS)-6-benzyl-5a,9-dimethyl-3,4,5,10b-tetrahydro-1H-azepino[4,3-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 143634212 |
| Molecular Formula | C26H34N2O2 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | tert-butyl (5aS)-6-benzyl-5a,9-dimethyl-3,4,5,10b-tetrahydro-1H-azepino[4,3-b]indole-2-carboxylate |
| SMILES | Cc1ccc2c(c1)C1CN(C(=O)OC(C)(C)C)CCC[C@]1(C)N2Cc1ccccc1 |
| InChI | InChI=1S/C26H34N2O2/c1-19-12-13-23-21(16-19)22-18-27(24(29)30-25(2,3)4)15-9-14-26(22,5)28(23)17-20-10-7-6-8-11-20/h6-8,10-13,16,22H,9,14-15,17-18H2,1-5H3/t22?,26-/m0/s1 |
| InChIKey | HFARACDWRJPBAS-XGCAABAXSA-N |
| XLogP | 5.89 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |