C18H24N2O5 — CID 134194715
tert-butyl 3-methyl-1-(4-methyl-2-nitrophenyl)-6-oxopiperidine-3-carboxylate (PubChem CID 134194715) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is tert-butyl 3-methyl-1-(4-methyl-2-nitrophenyl)-6-oxopiperidine-3-carboxylate.
| Compound Name | tert-butyl 3-methyl-1-(4-methyl-2-nitrophenyl)-6-oxopiperidine-3-carboxylate |
|---|---|
| PubChem CID | 134194715 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | tert-butyl 3-methyl-1-(4-methyl-2-nitrophenyl)-6-oxopiperidine-3-carboxylate |
| SMILES | Cc1ccc(N2CC(C)(C(=O)OC(C)(C)C)CCC2=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H24N2O5/c1-12-6-7-13(14(10-12)20(23)24)19-11-18(5,9-8-15(19)21)16(22)25-17(2,3)4/h6-7,10H,8-9,11H2,1-5H3 |
| InChIKey | BEJMENBCFIJHRE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|