C23H25FN2O5 — CID 122472988
tert-butyl 3-(4-fluorophenyl)-1-(4-methyl-2-nitrophenyl)-6-oxopiperidine-3-carboxylate (PubChem CID 122472988) has the molecular formula C23H25FN2O5 and a molecular weight of 428.46 g/mol. Its IUPAC name is tert-butyl 3-(4-fluorophenyl)-1-(4-methyl-2-nitrophenyl)-6-oxopiperidine-3-carboxylate.
| Compound Name | tert-butyl 3-(4-fluorophenyl)-1-(4-methyl-2-nitrophenyl)-6-oxopiperidine-3-carboxylate |
|---|---|
| PubChem CID | 122472988 |
| Molecular Formula | C23H25FN2O5 |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | tert-butyl 3-(4-fluorophenyl)-1-(4-methyl-2-nitrophenyl)-6-oxopiperidine-3-carboxylate |
| SMILES | Cc1ccc(N2CC(C(=O)OC(C)(C)C)(c3ccc(F)cc3)CCC2=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H25FN2O5/c1-15-5-10-18(19(13-15)26(29)30)25-14-23(12-11-20(25)27,21(28)31-22(2,3)4)16-6-8-17(24)9-7-16/h5-10,13H,11-12,14H2,1-4H3 |
| InChIKey | JGYHBZLEYKOGPD-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|