C26H24FNO3S — CID 134848064
tert-butyl (3S)-3-(4-fluorophenyl)-5-methyl-2-oxo-3-phenylsulfanylindole-1-carboxylate (PubChem CID 134848064) has the molecular formula C26H24FNO3S and a molecular weight of 449.55 g/mol. Its IUPAC name is tert-butyl (3S)-3-(4-fluorophenyl)-5-methyl-2-oxo-3-phenylsulfanylindole-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-(4-fluorophenyl)-5-methyl-2-oxo-3-phenylsulfanylindole-1-carboxylate |
|---|---|
| PubChem CID | 134848064 |
| Molecular Formula | C26H24FNO3S |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | tert-butyl (3S)-3-(4-fluorophenyl)-5-methyl-2-oxo-3-phenylsulfanylindole-1-carboxylate |
| SMILES | Cc1ccc2c(c1)[C@@](Sc1ccccc1)(c1ccc(F)cc1)C(=O)N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H24FNO3S/c1-17-10-15-22-21(16-17)26(18-11-13-19(27)14-12-18,32-20-8-6-5-7-9-20)23(29)28(22)24(30)31-25(2,3)4/h5-16H,1-4H3/t26-/m0/s1 |
| InChIKey | YEIMNAYGIVWYRZ-SANMLTNESA-N |
| XLogP | 6.45 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |