C21H20F3NO3S — CID 102236027
tert-butyl (3S)-5-methyl-2-oxo-3-phenyl-3-(trifluoromethylsulfanyl)indole-1-carboxylate (PubChem CID 102236027) has the molecular formula C21H20F3NO3S and a molecular weight of 423.46 g/mol. Its IUPAC name is tert-butyl (3S)-5-methyl-2-oxo-3-phenyl-3-(trifluoromethylsulfanyl)indole-1-carboxylate.
| Compound Name | tert-butyl (3S)-5-methyl-2-oxo-3-phenyl-3-(trifluoromethylsulfanyl)indole-1-carboxylate |
|---|---|
| PubChem CID | 102236027 |
| Molecular Formula | C21H20F3NO3S |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | tert-butyl (3S)-5-methyl-2-oxo-3-phenyl-3-(trifluoromethylsulfanyl)indole-1-carboxylate |
| SMILES | Cc1ccc2c(c1)[C@@](SC(F)(F)F)(c1ccccc1)C(=O)N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H20F3NO3S/c1-13-10-11-16-15(12-13)20(29-21(22,23)24,14-8-6-5-7-9-14)17(26)25(16)18(27)28-19(2,3)4/h5-12H,1-4H3/t20-/m0/s1 |
| InChIKey | FOIYXURWWRVXIR-FQEVSTJZSA-N |
| XLogP | 5.77 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |