C26H25NO3S — CID 132530946
tert-butyl (3S)-5-methyl-2-oxo-3-phenyl-3-phenylsulfanylindole-1-carboxylate (PubChem CID 132530946) has the molecular formula C26H25NO3S and a molecular weight of 431.56 g/mol. Its IUPAC name is tert-butyl (3S)-5-methyl-2-oxo-3-phenyl-3-phenylsulfanylindole-1-carboxylate.
| Compound Name | tert-butyl (3S)-5-methyl-2-oxo-3-phenyl-3-phenylsulfanylindole-1-carboxylate |
|---|---|
| PubChem CID | 132530946 |
| Molecular Formula | C26H25NO3S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | tert-butyl (3S)-5-methyl-2-oxo-3-phenyl-3-phenylsulfanylindole-1-carboxylate |
| SMILES | Cc1ccc2c(c1)[C@@](Sc1ccccc1)(c1ccccc1)C(=O)N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H25NO3S/c1-18-15-16-22-21(17-18)26(19-11-7-5-8-12-19,31-20-13-9-6-10-14-20)23(28)27(22)24(29)30-25(2,3)4/h5-17H,1-4H3/t26-/m0/s1 |
| InChIKey | FJQBMVYUONVFMN-SANMLTNESA-N |
| XLogP | 6.31 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |