C30H28N2O5 — CID 139259437
tert-butyl 3-[(3S)-1-(3-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-2-oxo-3-phenylindole-1-carboxylate (PubChem CID 139259437) has the molecular formula C30H28N2O5 and a molecular weight of 496.56 g/mol. Its IUPAC name is tert-butyl 3-[(3S)-1-(3-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-2-oxo-3-phenylindole-1-carboxylate.
| Compound Name | tert-butyl 3-[(3S)-1-(3-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-2-oxo-3-phenylindole-1-carboxylate |
|---|---|
| PubChem CID | 139259437 |
| Molecular Formula | C30H28N2O5 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | tert-butyl 3-[(3S)-1-(3-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-2-oxo-3-phenylindole-1-carboxylate |
| SMILES | Cc1cccc(N2C(=O)C[C@@H](C3(c4ccccc4)C(=O)N(C(=O)OC(C)(C)C)c4ccccc43)C2=O)c1 |
| InChI | InChI=1S/C30H28N2O5/c1-19-11-10-14-21(17-19)31-25(33)18-23(26(31)34)30(20-12-6-5-7-13-20)22-15-8-9-16-24(22)32(27(30)35)28(36)37-29(2,3)4/h5-17,23H,18H2,1-4H3/t23-,30?/m1/s1 |
| InChIKey | PITMHHSNLAYPHK-ZCQJSQKNSA-N |
| XLogP | 5.14 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|