C29H25ClN2O5 — CID 139259435
tert-butyl 3-[(3S)-1-(3-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-2-oxo-3-phenylindole-1-carboxylate (PubChem CID 139259435) has the molecular formula C29H25ClN2O5 and a molecular weight of 516.98 g/mol. Its IUPAC name is tert-butyl 3-[(3S)-1-(3-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-2-oxo-3-phenylindole-1-carboxylate.
| Compound Name | tert-butyl 3-[(3S)-1-(3-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-2-oxo-3-phenylindole-1-carboxylate |
|---|---|
| PubChem CID | 139259435 |
| Molecular Formula | C29H25ClN2O5 |
| Molecular Weight | 516.98 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | tert-butyl 3-[(3S)-1-(3-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-2-oxo-3-phenylindole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)C(c2ccccc2)([C@@H]2CC(=O)N(c3cccc(Cl)c3)C2=O)c2ccccc21 |
| InChI | InChI=1S/C29H25ClN2O5/c1-28(2,3)37-27(36)32-23-15-8-7-14-21(23)29(26(32)35,18-10-5-4-6-11-18)22-17-24(33)31(25(22)34)20-13-9-12-19(30)16-20/h4-16,22H,17H2,1-3H3/t22-,29?/m1/s1 |
| InChIKey | JTRUZELOBMXKOO-DMDVIOLWSA-N |
| XLogP | 5.49 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.98 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|