C28H26N2O6 — CID 102225503
tert-butyl (3R)-3-[(1R,2S,3R)-3-hydroxy-2-nitro-2,3-dihydro-1H-inden-1-yl]-2-oxo-3-phenylindole-1-carboxylate (PubChem CID 102225503) has the molecular formula C28H26N2O6 and a molecular weight of 486.52 g/mol. Its IUPAC name is tert-butyl (3R)-3-[(1R,2S,3R)-3-hydroxy-2-nitro-2,3-dihydro-1H-inden-1-yl]-2-oxo-3-phenylindole-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[(1R,2S,3R)-3-hydroxy-2-nitro-2,3-dihydro-1H-inden-1-yl]-2-oxo-3-phenylindole-1-carboxylate |
|---|---|
| PubChem CID | 102225503 |
| Molecular Formula | C28H26N2O6 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | tert-butyl (3R)-3-[(1R,2S,3R)-3-hydroxy-2-nitro-2,3-dihydro-1H-inden-1-yl]-2-oxo-3-phenylindole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)[C@@](c2ccccc2)([C@H]2c3ccccc3[C@@H](O)[C@H]2[N+](=O)[O-])c2ccccc21 |
| InChI | InChI=1S/C28H26N2O6/c1-27(2,3)36-26(33)29-21-16-10-9-15-20(21)28(25(29)32,17-11-5-4-6-12-17)22-18-13-7-8-14-19(18)24(31)23(22)30(34)35/h4-16,22-24,31H,1-3H3/t22-,23-,24+,28+/m0/s1 |
| InChIKey | UKYJYDLZNQCIPR-FLSMRUOLSA-N |
| XLogP | 4.73 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|