C31H32N2O7 — CID 71659156
tert-butyl (1S,2R,3S,4S,6S)-6-hydroxy-2-(4-methoxyphenyl)-3-nitro-2'-oxo-4-phenylspiro[cyclohexane-1,3'-indole]-1'-carboxylate (PubChem CID 71659156) has the molecular formula C31H32N2O7 and a molecular weight of 544.60 g/mol. Its IUPAC name is tert-butyl (1S,2R,3S,4S,6S)-6-hydroxy-2-(4-methoxyphenyl)-3-nitro-2'-oxo-4-phenylspiro[cyclohexane-1,3'-indole]-1'-carboxylate.
| Compound Name | tert-butyl (1S,2R,3S,4S,6S)-6-hydroxy-2-(4-methoxyphenyl)-3-nitro-2'-oxo-4-phenylspiro[cyclohexane-1,3'-indole]-1'-carboxylate |
|---|---|
| PubChem CID | 71659156 |
| Molecular Formula | C31H32N2O7 |
| Molecular Weight | 544.60 g/mol |
| Exact Mass | 544.22 |
| IUPAC Name | tert-butyl (1S,2R,3S,4S,6S)-6-hydroxy-2-(4-methoxyphenyl)-3-nitro-2'-oxo-4-phenylspiro[cyclohexane-1,3'-indole]-1'-carboxylate |
| SMILES | COc1ccc([C@H]2[C@@H]([N+](=O)[O-])[C@H](c3ccccc3)C[C@H](O)[C@]23C(=O)N(C(=O)OC(C)(C)C)c2ccccc23)cc1 |
| InChI | InChI=1S/C31H32N2O7/c1-30(2,3)40-29(36)32-24-13-9-8-12-23(24)31(28(32)35)25(34)18-22(19-10-6-5-7-11-19)27(33(37)38)26(31)20-14-16-21(39-4)17-15-20/h5-17,22,25-27,34H,18H2,1-4H3/t22-,25-,26-,27-,31-/m0/s1 |
| InChIKey | DFMLWMVZUZCDCR-FLMWBLAISA-N |
| XLogP | 5.19 |
| TPSA | 119.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.60 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|