C25H32N2O9 — CID 122380076
1-O'-tert-butyl 1-O-ethyl (1R,2S,3S,6R)-3-(2-ethoxy-2-oxoethyl)-6-nitro-2'-oxospiro[cyclohexane-2,3'-indole]-1,1'-dicarboxylate (PubChem CID 122380076) has the molecular formula C25H32N2O9 and a molecular weight of 504.54 g/mol. Its IUPAC name is 1-O'-tert-butyl 1-O-ethyl (1R,2S,3S,6R)-3-(2-ethoxy-2-oxoethyl)-6-nitro-2'-oxospiro[cyclohexane-2,3'-indole]-1,1'-dicarboxylate.
| Compound Name | 1-O'-tert-butyl 1-O-ethyl (1R,2S,3S,6R)-3-(2-ethoxy-2-oxoethyl)-6-nitro-2'-oxospiro[cyclohexane-2,3'-indole]-1,1'-dicarboxylate |
|---|---|
| PubChem CID | 122380076 |
| Molecular Formula | C25H32N2O9 |
| Molecular Weight | 504.54 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | 1-O'-tert-butyl 1-O-ethyl (1R,2S,3S,6R)-3-(2-ethoxy-2-oxoethyl)-6-nitro-2'-oxospiro[cyclohexane-2,3'-indole]-1,1'-dicarboxylate |
| SMILES | CCOC(=O)C[C@@H]1CC[C@@H]([N+](=O)[O-])[C@H](C(=O)OCC)[C@@]12C(=O)N(C(=O)OC(C)(C)C)c1ccccc12 |
| InChI | InChI=1S/C25H32N2O9/c1-6-34-19(28)14-15-12-13-18(27(32)33)20(21(29)35-7-2)25(15)16-10-8-9-11-17(16)26(22(25)30)23(31)36-24(3,4)5/h8-11,15,18,20H,6-7,12-14H2,1-5H3/t15-,18+,20+,25+/m0/s1 |
| InChIKey | LXGPVBUMTJUJSK-MOLVFEROSA-N |
| XLogP | 3.39 |
| TPSA | 142.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.54 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|