C38H40N2O9 — CID 122386902
tert-butyl (3S)-3-[(1S,2S,3S,4S,5R)-2-(2-ethoxy-2-oxoethyl)-3-[(E)-3-methoxy-3-oxoprop-1-enyl]-5-nitro-4-phenylcyclopentyl]-2-oxo-3-phenylindole-1-carboxylate (PubChem CID 122386902) has the molecular formula C38H40N2O9 and a molecular weight of 668.74 g/mol. Its IUPAC name is tert-butyl (3S)-3-[(1S,2S,3S,4S,5R)-2-(2-ethoxy-2-oxoethyl)-3-[(E)-3-methoxy-3-oxoprop-1-enyl]-5-nitro-4-phenylcyclopentyl]-2-oxo-3-phenylindole-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[(1S,2S,3S,4S,5R)-2-(2-ethoxy-2-oxoethyl)-3-[(E)-3-methoxy-3-oxoprop-1-enyl]-5-nitro-4-phenylcyclopentyl]-2-oxo-3-phenylindole-1-carboxylate |
|---|---|
| PubChem CID | 122386902 |
| Molecular Formula | C38H40N2O9 |
| Molecular Weight | 668.74 g/mol |
| Exact Mass | 668.27 |
| IUPAC Name | tert-butyl (3S)-3-[(1S,2S,3S,4S,5R)-2-(2-ethoxy-2-oxoethyl)-3-[(E)-3-methoxy-3-oxoprop-1-enyl]-5-nitro-4-phenylcyclopentyl]-2-oxo-3-phenylindole-1-carboxylate |
| SMILES | CCOC(=O)C[C@H]1[C@H](/C=C/C(=O)OC)[C@@H](c2ccccc2)[C@@H]([N+](=O)[O-])[C@@H]1[C@@]1(c2ccccc2)C(=O)N(C(=O)OC(C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C38H40N2O9/c1-6-48-31(42)23-27-26(21-22-30(41)47-5)32(24-15-9-7-10-16-24)34(40(45)46)33(27)38(25-17-11-8-12-18-25)28-19-13-14-20-29(28)39(35(38)43)36(44)49-37(2,3)4/h7-22,26-27,32-34H,6,23H2,1-5H3/b22-21+/t26-,27-,32+,33+,34+,38-/m0/s1 |
| InChIKey | DMRFWOJSQGEGCR-KBUYKRCUSA-N |
| XLogP | 6.23 |
| TPSA | 142.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.74 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|