C25H28N2O6 — CID 71659953
tert-butyl (1R,2R,3R,4R,6R)-6-hydroxy-4-methyl-3-nitro-2'-oxo-2-phenylspiro[cyclohexane-1,3'-indole]-1'-carboxylate (PubChem CID 71659953) has the molecular formula C25H28N2O6 and a molecular weight of 452.51 g/mol. Its IUPAC name is tert-butyl (1R,2R,3R,4R,6R)-6-hydroxy-4-methyl-3-nitro-2'-oxo-2-phenylspiro[cyclohexane-1,3'-indole]-1'-carboxylate.
| Compound Name | tert-butyl (1R,2R,3R,4R,6R)-6-hydroxy-4-methyl-3-nitro-2'-oxo-2-phenylspiro[cyclohexane-1,3'-indole]-1'-carboxylate |
|---|---|
| PubChem CID | 71659953 |
| Molecular Formula | C25H28N2O6 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | tert-butyl (1R,2R,3R,4R,6R)-6-hydroxy-4-methyl-3-nitro-2'-oxo-2-phenylspiro[cyclohexane-1,3'-indole]-1'-carboxylate |
| SMILES | C[C@@H]1C[C@@H](O)[C@@]2(C(=O)N(C(=O)OC(C)(C)C)c3ccccc32)[C@@H](c2ccccc2)[C@@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C25H28N2O6/c1-15-14-19(28)25(20(21(15)27(31)32)16-10-6-5-7-11-16)17-12-8-9-13-18(17)26(22(25)29)23(30)33-24(2,3)4/h5-13,15,19-21,28H,14H2,1-4H3/t15-,19-,20+,21-,25-/m1/s1 |
| InChIKey | LXSHZPSUOWBRCT-GDWURWJBSA-N |
| XLogP | 4.04 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|