C27H25FN2O5 — CID 102125474
tert-butyl (3S)-3-[(1S)-1-(2-fluorophenyl)-2-nitroethyl]-2-oxo-3-phenylindole-1-carboxylate (PubChem CID 102125474) has the molecular formula C27H25FN2O5 and a molecular weight of 476.50 g/mol. Its IUPAC name is tert-butyl (3S)-3-[(1S)-1-(2-fluorophenyl)-2-nitroethyl]-2-oxo-3-phenylindole-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[(1S)-1-(2-fluorophenyl)-2-nitroethyl]-2-oxo-3-phenylindole-1-carboxylate |
|---|---|
| PubChem CID | 102125474 |
| Molecular Formula | C27H25FN2O5 |
| Molecular Weight | 476.50 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | tert-butyl (3S)-3-[(1S)-1-(2-fluorophenyl)-2-nitroethyl]-2-oxo-3-phenylindole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)[C@](c2ccccc2)([C@H](C[N+](=O)[O-])c2ccccc2F)c2ccccc21 |
| InChI | InChI=1S/C27H25FN2O5/c1-26(2,3)35-25(32)30-23-16-10-8-14-20(23)27(24(30)31,18-11-5-4-6-12-18)21(17-29(33)34)19-13-7-9-15-22(19)28/h4-16,21H,17H2,1-3H3/t21-,27+/m1/s1 |
| InChIKey | VICGQDCLZWSKEA-ZBLYBZFDSA-N |
| XLogP | 5.45 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.50 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|