C13H17FN2O4 — CID 174569642
tert-butyl N-[1-(2-fluorophenyl)-2-nitroethyl]carbamate (PubChem CID 174569642) has the molecular formula C13H17FN2O4 and a molecular weight of 284.29 g/mol. Its IUPAC name is tert-butyl N-[1-(2-fluorophenyl)-2-nitroethyl]carbamate.
| Compound Name | tert-butyl N-[1-(2-fluorophenyl)-2-nitroethyl]carbamate |
|---|---|
| PubChem CID | 174569642 |
| Molecular Formula | C13H17FN2O4 |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | tert-butyl N-[1-(2-fluorophenyl)-2-nitroethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(C[N+](=O)[O-])c1ccccc1F |
| InChI | InChI=1S/C13H17FN2O4/c1-13(2,3)20-12(17)15-11(8-16(18)19)9-6-4-5-7-10(9)14/h4-7,11H,8H2,1-3H3,(H,15,17) |
| InChIKey | LYKIHZSNMMMVTR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|