C14H19FN2O5 — CID 162720881
tert-butyl N-[1-(2-fluoro-5-nitrophenyl)-3-hydroxypropyl]carbamate (PubChem CID 162720881) has the molecular formula C14H19FN2O5 and a molecular weight of 314.31 g/mol. Its IUPAC name is tert-butyl N-[1-(2-fluoro-5-nitrophenyl)-3-hydroxypropyl]carbamate.
| Compound Name | tert-butyl N-[1-(2-fluoro-5-nitrophenyl)-3-hydroxypropyl]carbamate |
|---|---|
| PubChem CID | 162720881 |
| Molecular Formula | C14H19FN2O5 |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | tert-butyl N-[1-(2-fluoro-5-nitrophenyl)-3-hydroxypropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CCO)c1cc([N+](=O)[O-])ccc1F |
| InChI | InChI=1S/C14H19FN2O5/c1-14(2,3)22-13(19)16-12(6-7-18)10-8-9(17(20)21)4-5-11(10)15/h4-5,8,12,18H,6-7H2,1-3H3,(H,16,19) |
| InChIKey | ULLKWGISKNDBFO-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|