C22H20BrF3N2O5 — CID 102363906
tert-butyl (3R)-6-bromo-2-oxo-3-phenyl-3-[(2R)-1,1,1-trifluoro-3-nitropropan-2-yl]indole-1-carboxylate (PubChem CID 102363906) has the molecular formula C22H20BrF3N2O5 and a molecular weight of 529.31 g/mol. Its IUPAC name is tert-butyl (3R)-6-bromo-2-oxo-3-phenyl-3-[(2R)-1,1,1-trifluoro-3-nitropropan-2-yl]indole-1-carboxylate.
| Compound Name | tert-butyl (3R)-6-bromo-2-oxo-3-phenyl-3-[(2R)-1,1,1-trifluoro-3-nitropropan-2-yl]indole-1-carboxylate |
|---|---|
| PubChem CID | 102363906 |
| Molecular Formula | C22H20BrF3N2O5 |
| Molecular Weight | 529.31 g/mol |
| Exact Mass | 528.05 |
| IUPAC Name | tert-butyl (3R)-6-bromo-2-oxo-3-phenyl-3-[(2R)-1,1,1-trifluoro-3-nitropropan-2-yl]indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)[C@@](c2ccccc2)([C@H](C[N+](=O)[O-])C(F)(F)F)c2ccc(Br)cc21 |
| InChI | InChI=1S/C22H20BrF3N2O5/c1-20(2,3)33-19(30)28-16-11-14(23)9-10-15(16)21(18(28)29,13-7-5-4-6-8-13)17(12-27(31)32)22(24,25)26/h4-11,17H,12H2,1-3H3/t17-,21+/m0/s1 |
| InChIKey | ANFKKUZSXOMHRJ-LAUBAEHRSA-N |
| XLogP | 5.47 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.31 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|