C28H35BrNO8P — CID 102428670
tert-butyl (3R)-5-bromo-3-[(2S)-2-diethoxyphosphoryl-3-ethoxy-3-oxopropyl]-2-oxo-3-phenylindole-1-carboxylate (PubChem CID 102428670) has the molecular formula C28H35BrNO8P and a molecular weight of 624.47 g/mol. Its IUPAC name is tert-butyl (3R)-5-bromo-3-[(2S)-2-diethoxyphosphoryl-3-ethoxy-3-oxopropyl]-2-oxo-3-phenylindole-1-carboxylate.
| Compound Name | tert-butyl (3R)-5-bromo-3-[(2S)-2-diethoxyphosphoryl-3-ethoxy-3-oxopropyl]-2-oxo-3-phenylindole-1-carboxylate |
|---|---|
| PubChem CID | 102428670 |
| Molecular Formula | C28H35BrNO8P |
| Molecular Weight | 624.47 g/mol |
| Exact Mass | 623.13 |
| IUPAC Name | tert-butyl (3R)-5-bromo-3-[(2S)-2-diethoxyphosphoryl-3-ethoxy-3-oxopropyl]-2-oxo-3-phenylindole-1-carboxylate |
| SMILES | CCOC(=O)[C@H](C[C@]1(c2ccccc2)C(=O)N(C(=O)OC(C)(C)C)c2ccc(Br)cc21)P(=O)(OCC)OCC |
| InChI | InChI=1S/C28H35BrNO8P/c1-7-35-24(31)23(39(34,36-8-2)37-9-3)18-28(19-13-11-10-12-14-19)21-17-20(29)15-16-22(21)30(25(28)32)26(33)38-27(4,5)6/h10-17,23H,7-9,18H2,1-6H3/t23-,28+/m0/s1 |
| InChIKey | RNJYFEVHVAYAGN-NEKDWFFYSA-N |
| XLogP | 6.60 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.47 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|