C27H37NO9P2 — CID 70676923
ethyl (3R)-3-[2,2-bis(diethoxyphosphoryl)ethyl]-2-oxo-3-phenylindole-1-carboxylate (PubChem CID 70676923) has the molecular formula C27H37NO9P2 and a molecular weight of 581.54 g/mol. Its IUPAC name is ethyl (3R)-3-[2,2-bis(diethoxyphosphoryl)ethyl]-2-oxo-3-phenylindole-1-carboxylate.
| Compound Name | ethyl (3R)-3-[2,2-bis(diethoxyphosphoryl)ethyl]-2-oxo-3-phenylindole-1-carboxylate |
|---|---|
| PubChem CID | 70676923 |
| Molecular Formula | C27H37NO9P2 |
| Molecular Weight | 581.54 g/mol |
| Exact Mass | 581.19 |
| IUPAC Name | ethyl (3R)-3-[2,2-bis(diethoxyphosphoryl)ethyl]-2-oxo-3-phenylindole-1-carboxylate |
| SMILES | CCOC(=O)N1C(=O)[C@](CC(P(=O)(OCC)OCC)P(=O)(OCC)OCC)(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C27H37NO9P2/c1-6-33-26(30)28-23-19-15-14-18-22(23)27(25(28)29,21-16-12-11-13-17-21)20-24(38(31,34-7-2)35-8-3)39(32,36-9-4)37-10-5/h11-19,24H,6-10,20H2,1-5H3/t27-/m1/s1 |
| InChIKey | ODACDYJWQDEPGQ-HHHXNRCGSA-N |
| XLogP | 6.72 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.54 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|