C29H40ClNO9P2 — CID 70676286
tert-butyl (3R)-3-[2,2-bis(diethoxyphosphoryl)ethyl]-6-chloro-2-oxo-3-phenylindole-1-carboxylate (PubChem CID 70676286) has the molecular formula C29H40ClNO9P2 and a molecular weight of 644.04 g/mol. Its IUPAC name is tert-butyl (3R)-3-[2,2-bis(diethoxyphosphoryl)ethyl]-6-chloro-2-oxo-3-phenylindole-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[2,2-bis(diethoxyphosphoryl)ethyl]-6-chloro-2-oxo-3-phenylindole-1-carboxylate |
|---|---|
| PubChem CID | 70676286 |
| Molecular Formula | C29H40ClNO9P2 |
| Molecular Weight | 644.04 g/mol |
| Exact Mass | 643.19 |
| IUPAC Name | tert-butyl (3R)-3-[2,2-bis(diethoxyphosphoryl)ethyl]-6-chloro-2-oxo-3-phenylindole-1-carboxylate |
| SMILES | CCOP(=O)(OCC)C(C[C@]1(c2ccccc2)C(=O)N(C(=O)OC(C)(C)C)c2cc(Cl)ccc21)P(=O)(OCC)OCC |
| InChI | InChI=1S/C29H40ClNO9P2/c1-8-36-41(34,37-9-2)25(42(35,38-10-3)39-11-4)20-29(21-15-13-12-14-16-21)23-18-17-22(30)19-24(23)31(26(29)32)27(33)40-28(5,6)7/h12-19,25H,8-11,20H2,1-7H3/t29-/m1/s1 |
| InChIKey | UIYSCVNJOAADBB-GDLZYMKVSA-N |
| XLogP | 8.16 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.04 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|